A 943931 dihydrochloride
A 943931 dihydrochloride is a potent and selective histamine H4 receptor antagonist (pKi = 7.15 and 8.12 at human and rat receptors, respectively). A 943931 blocks inflammation in a peritonitis mouse model and displays efficacy in inflammatory pain and neuropathic pain models.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1227675-50-4 |
| Pricing | Inquire |
| Cas | 1227675-50-4 |
| Molecular Weight | 368.31 |
| Molecular Formula | C17H21N5.2HCl |
| Canonical SMILES | C1CC2=CC=CC=C2C3=C(C1)C(=NC(=N3)N)N4CCC(C4)N.Cl.Cl |