Epoxy Fluor 7
Epoxy fluor 7 is a sensitive fluorescent substrate for soluble epoxide hydrolase (sEH) that can be used for human and mouse enzymes. Epoxy fluor 7 is hydrolyzed to yield fluorescence used for monitoring the activity of sEH.
| Supplier | BOC Sciences |
|---|---|
| Product # | 863223-43-2 |
| Pricing | Inquire |
| Cas | 863223-43-2 |
| Molecular Weight | 389.4 |
| Molecular Formula | C23H19NO5 |
| Canonical SMILES | COC1=CC2=C(C=C1)C=C(C=C2)C(C#N)OC(=O)OCC3C(O3)C4=CC=CC=C4 |