Ezetimibe Aniline Impurity
An impurity of Ezetimibe. Ezetimibe inhibits intestinal cholesterol absorption by preventing cholesterol uptake by the Niemann-Pick C1-like 1 (NPC1L28) protein, a cholesterol transporter located in the apical membrane of enterocytes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1354716-98-5 |
| Pricing | Inquire |
| Cas | 1354716-98-5 |
| Molecular Weight | 408.45 |
| Molecular Formula | C24H22F2N2O2 |
| Canonical SMILES | C1=CC(=CC=C1C2C(C(=O)N2C3=CC=C(C=C3)F)CCC(C4=CC=C(C=C4)F)O)N |