Methyl 3,4-di-O-acetyl-b-D-xylopyranoside
Methyl 3,4-di-O-acetyl-b-D-xylopyranoside is an invaluable bioactive compound, preeminent among its manifold utilities lies its commendable proficiency in catalyzing the synthesis of carbohydrate-based medicaments that is targeted at the formidable triad of cancerous growth, inflammatory responses and pernicious bacterial invasions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 63629-70-9 |
| Pricing | Inquire |
| Cas | 63629-70-9 |
| Molecular Weight | 248.2 |
| Molecular Formula | C10H16O7 |
| Canonical SMILES | CC(=O)OC1COC(C(C1OC(=O)C)O)OC |