Oxytocin C-terminal tripeptide acetate
Oxytocin C-terminal tripeptide acetate, an inhibitor of melanocyte-stimulating hormone (MSH) release, blocks the release of α-MSH, increases brain dopamine levels, and antagonizes physiological and behavioral opioid effects in vivo.
Supplier | BOC Sciences |
---|---|
Product # | BAT-016157 |
Pricing | Inquire |
Cas | 1207536-22-8 |
Molecular Weight | 344.41 |
Molecular Formula | C15H28N4O5 |
Canonical SMILES | CC(C)CC(C(=O)NCC(=O)N)NC(=O)C1CCCN1.CC(=O)O |