2-Hydroxyaclacinomycin A
2-Hydroxyaclacinomycin A is an anthracycline antibiotic produced by Strptomyces galilaeus AM144-M1 mutant strain KE303. It has the activity of inhibiting leukemia L-1210 cells, and the IC50 for RNA and DNA synthesis is 0.10 μg/mL and 0.95 μg/mL, respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00983 |
| Pricing | Inquire |
| Cas | 79127-36-9 |
| Molecular Weight | 827.87 |
| Molecular Formula | C42H53NO16 |
| Canonical SMILES | CCC1(CC(C2=C(C3=C(C=C2C1C(=O)OC)C(=O)C4=C(C3=O)C(=CC(=C4)O)O)O)OC5CC(C(C(O5)C)OC6CC(C(C(O6)C)OC7CCC(=O)C(O7)C)O)N(C)C)O |