Cobimetinib (R-enantiomer)
Cobimetinib (R-enantiomer) is a selective inhibitor of MEK. It is also known as mitogen activated protein kinase kinase (MAPKK) and is a key component of the RAS/RAF/MEK/ERK pathway, which is frequently activated in human tumors.
| Supplier | BOC Sciences |
|---|---|
| Product # | 934660-94-3 |
| Pricing | Inquire |
| Cas | 934660-94-3 |
| Molecular Weight | 531.31 |
| Molecular Formula | C21H21F3IN3O2 |
| Canonical SMILES | C1CCNC(C1)C2(CN(C2)C(=O)C3=C(C(=C(C=C3)F)F)NC4=C(C=C(C=C4)I)F)O |