(5-methoxybenzofuran-2-yl)boronic acid
5-Methoxy-2-benzofuranboronic Acid serves as a reagent in the development and preparation of 99mTc-labeled pyridyl benzofuran derivatives to detect pancreatic amylin in islet amyloid model mice. Also serves as a reagent in the preparation of dihydropyrazoles as FSH receptor modulators useful in the treatment of fertility disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB028913 |
| Pricing | Inquire |
| Cas | 551001-79-7 |
| Molecular Weight | 191.977 |
| Molecular Formula | C9H9BO4 |
| Canonical SMILES | B(C1=CC2=C(O1)C=CC(=C2)OC)(O)O |