5'-Deoxy-4',5'-didehydro-2'-O-methyluridine
5'-Deoxy-4',5'-didehydro-2'-O-methyluridine, an essential biomolecule within the biomedical sector, showcases immense significance. It assumes a critical role in advancing antiviral therapeutics and combating diverse ailments. Leveraging its formidable antiviral attributes, this compound emerges as a compelling contender against viral infections like HIV and hepatitis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1848223-48-2 |
| Pricing | Inquire |
| Cas | 1848223-48-2 |
| Molecular Weight | 240.22 |
| Molecular Formula | C10H12N2O5 |
| Canonical SMILES | COC1C(C(=C)OC1N2C=CC(=O)NC2=O)O |