6-(2-Cyanoethylthio)-2'-deoxy-5'-O-DMT-N2-trifluoroacetylguanosine 3'-CE phosphoramidite
6-(2-Cyanoethylthio)-2'-deoxy-5'-O-DMT-N2-trifluoroacetylguanosine 3'-CE phosphoramidite, an indispensable compound within the biomedical industry, holds immense significance. Its usage predominantly lies in nucleotide synthesis during the production of DNA and RNA. This phosphoramidite facilitates the efficient incorporation of guanosine residues into oligonucleotides, ensuring site-specificity. By virtue of its distinctive chemical configuration, it exhibits utility in the treatment of diverse ailments, encompassing viral infections and certain genetic disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 146691-59-0 |
| Pricing | Inquire |
| Cas | 146691-59-0 |
| Molecular Weight | 934.97 |
| Molecular Formula | C45H50F3N8O7PS |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1CC(OC1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)N5C=NC6=C5N=C(N=C6SCCC#N)NC(=O)C(F)(F)F |