tert-Butyl 2-acetamido-2-deoxy-b-D-glucopyranoside
tert-Butyl 2-acetamido-2-deoxy-b-D-glucopyranoside, a fascinating compound, finds profound utility in the ever-evolving biomedical sphere. This compound's multifaceted characteristics empower its deployment in synthesizing glycosyl conjugates and glycosaminoglycans - pivotal agents in orchestrating intricate biological processes.
| Supplier | BOC Sciences |
|---|---|
| Product # | B1999-104143 |
| Pricing | Inquire |
| Cas | 262849-69-4 |
| Molecular Weight | 277.31 |
| Molecular Formula | C12H23NO6 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OC(C)(C)C)CO)O)O |