1,6-Anhydro-2,3-O-isopropylidene-b-D-mannopyranose
1,6-Anhydro-2,3-O-isopropylidene-b-D-mannopyranose, a compound of immense value, finds application in the realm of biomedicine. Its distinctive chemical structure bestows it with crucial significance as an intermediate for the synthesis of antiviral pharmaceuticals and carbohydrate-based therapeutic agents.
| Supplier | BOC Sciences |
|---|---|
| Product # | 14440-51-8 |
| Pricing | Inquire |
| Cas | 14440-51-8 |
| Molecular Weight | 202.20 |
| Molecular Formula | C9H14O5 |
| Canonical SMILES | CC1(OC2C(C3COC(C2O1)O3)O)C |