Cerberic acid
Cerberic acid is extracted from the herbs of Cerbera manghas L. It shows weak cytotoxic activity against HeLa, MCF-7 and HepG2 cell lines with IC50 values of 48.7, 52.3 and 44.7 ug/ml, respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP3889 |
| Pricing | Inquire |
| Cas | 65597-44-6 |
| Molecular Weight | 220.18 |
| Molecular Formula | C11H8O5 |
| Canonical SMILES | COC(=O)C1=COC=C2C1=CC=C2C(=O)O |