Dactylfungin B
Dactylfungin is an antifungal antibiotic produced by Dactylaria parvispora D500, and two components A and B are separated. A and B have no antibacterial activity. B is resistant to individual Candida and Saccharomyces fungi (MIC 3.1-6.2 μg/mL), and has a weak effect on important pathogenic fungi such as Candida albicans (MIC >100μg/mL).
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00779 |
| Pricing | Inquire |
| Cas | 146935-36-6 |
| Molecular Weight | 700.94 |
| Molecular Formula | C41H64O9 |
| Canonical SMILES | CCC(C)\C=C(/C)\C=C\C=C(/C)\CC(C)CC(C)CC(CO)\C=C(/C)\C=C\C(O)C(C)(C)C1=CC(=O)C(=C(O)O1)[C@@H]2O[C@H](CO)C[C@H](O)[C@H]2O |