NIR-641 N-succinimidyl ester
NIR-641 N-succinimidyl ester is a potential compound in the biomedical field and plays an integral role in promoting the labeling and imaging of biomolecules. Its unique structure caters for the precise fusion of fluorophores with proteins, DNA, and other important biomolecules, enabling exquisite biological imaging.
| Supplier | BOC Sciences |
|---|---|
| Product # | 190714-26-2 |
| Pricing | Inquire |
| Cas | 190714-26-2 |
| Molecular Weight | 630.22 |
| Molecular Formula | C37H44ClN3O4 |
| Canonical SMILES | CCN1C2=CC=CC=C2C(C1=CC=CC=CC3=[N+](C4=CC=CC=C4C3(C)C)CCCCCC(=O)ON5C(=O)CCC5=O)(C)C.[Cl-] |