Methyl 2-Hydroxy-3-nitrobenzoate
Methyl 2-Hydroxy-3-nitrobenzoate (CAS# 22621-41-6) is an derivative of 3-Nitrosalicylic acid (N520905), which has been shown to bind to Molybdenum to impart fertility to soil and water and is a key element in the activity of nitrogenase.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB017688 |
| Pricing | Inquire |
| Cas | 22621-41-6 |
| Molecular Weight | 197.14 |
| Molecular Formula | C8H7NO5 |
| Canonical SMILES | COC(=O)C1=C(C(=CC=C1)[N+](=O)[O-])O |