Ellagic acid
Ellagic acid is a natural phenol antioxidant found in numerous fruits and vegetables. The antiproliferative and antioxidant properties of ellagic acid have prompted research into its potential health benefits. It has been fraudulently marketed as having the ability to prevent and treat a number of human maladies, including cancer, but such claims have not been proven. Ellagic acid can be used in cosmetics material.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP5371 |
| Pricing | Inquire |
| Cas | 476-66-4 |
| Molecular Weight | 302.19 |
| Molecular Formula | C14H6O8 |
| Canonical SMILES | C1=C2C3=C(C(=C1O)O)OC(=O)C4=CC(=C(C(=C43)OC2=O)O)O |