Methyl 2,3,4-tri-O-benzoyl-6-O-triisopropylsilyl-a-D-galactopyranoside
Methyl 2,3,4-tri-O-benzoyl-6-O-triisopropylsilyl-α-D-galactopyranoside, an indispensable compound in the biomedical sector, holds immense significance. By serving as a foundational component, it paves the way for the creation of carbohydrate-derived pharmaceuticals and biologically active substances.
| Supplier | BOC Sciences |
|---|---|
| Product # | 356060-82-7 |
| Pricing | Inquire |
| Cas | 356060-82-7 |
| Molecular Weight | 662.84 |
| Molecular Formula | C37H46O9Si |
| Canonical SMILES | CC(C)[Si](C(C)C)(C(C)C)OCC1C(C(C(C(O1)OC)OC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4 |