2,3-O-Isopropylidene-5-O-triphenylmethyl-D-ribonic acid γ-lactone
2,3-O-Isopropylidene-5-O-triphenylmethyl-D-ribonic acid γ-lactone, known for its intricate molecular structure, is an exceedingly versatile compound highly sought after in the biomedical realm. Renowned for its exceptional pharmacological attributes, this compound showcases substantial prospects in combating an array of ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 106886-17-3 |
| Pricing | Inquire |
| Cas | 106886-17-3 |
| Molecular Weight | 430.50 |
| Molecular Formula | C27H26O5 |
| Canonical SMILES | O=C1OC(COC(C=2C=CC=CC2)(C=3C=CC=CC3)C=4C=CC=CC4)C5OC(OC15)(C)C |