M‑89
M-89 is a highly potent and specific menin inhibitor, with a Kd of 1.4 nM for binding to menin. M-89 inhibits protein-protein interaction of menin-mixed lineage leukemia (Menin-MLL), and has the potential to treat MLL leukemia.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2363165-42-6 |
| Pricing | Inquire |
| Cas | 2363165-42-6 |
| Molecular Weight | 657.87 |
| Molecular Formula | C37H47N5O4S |
| Canonical SMILES | CNC(=O)OC1CCCC1C2(CN(CC3=CC=CC=C32)C)C4CCN(CC4)CC5CN(C5)C6=CC=C(C=C6)S(=O)(=O)C7=CC=NC=C7 |