Semilicoisoflavone B
Semilicoisoflavone B is a compound of the flavonoid class found in the roots of Glycyrrhiza uralensis Fisch. Study shows that Semilicoisoflavone B inhibits sorbitol formation of rat lens incubated with a high concentration of glucose.
Supplier | BOC Sciences |
---|---|
Product # | NP2036 |
Pricing | Inquire |
Cas | 129280-33-7 |
Molecular Weight | 352.342 |
Molecular Formula | C20H16O6 |
Canonical SMILES | CC1(C=CC2=C(O1)C(=CC(=C2)C3=COC4=CC(=CC(=C4C3=O)O)O)O)C |