5'-Chloro-5'-deoxyadenosine
5'-Chloro-5'-deoxyadenosine (CAS# 892-48-8) is an intermediate in the synthesis of 5'-Deoxy-5'-(methylthio)adenosine (D242600), a substrate to study the specificity and kinetics of 5'-methylthioadenosinephosphorylase (MTAP) (EC2.4.2.28), a tumor suppressor gene expressed enzyme that supports the S-adenosylmethionine (AdoMet) and methionine salvage pathways.
| Supplier | BOC Sciences |
|---|---|
| Product # | 892-48-8 |
| Pricing | Inquire |
| Cas | 892-48-8 |
| Molecular Weight | 285.69 |
| Molecular Formula | C10H12ClN5O3 |
| Canonical SMILES | C1=NC2=C(C(=N1)N)N=CN2C3C(C(C(O3)CCl)O)O |