8-oxo-dG-CE Phosphoramidite
8-oxo-dG-CE Phosphoramidite is an indispensable compound assuming a pivotal role in oligonucleotide research and development. Its contributes to the exploration of therapeutic drugs aimed at DNA repair and ailments associated with oxidative stress.
| Supplier | BOC Sciences |
|---|---|
| Product # | 143060-53-1 |
| Pricing | Inquire |
| Cas | 143060-53-1 |
| Molecular Weight | 855.93 |
| Molecular Formula | C44H54N7O9P |
| Canonical SMILES | CC(C)C(=O)NC1=NC(=O)C2=C(N1)N(C(=O)N2)C3CC(C(O3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)OP(N(C(C)C)C(C)C)OCCC#N |