Uric acid sodium
Uric acid sodium, scavenger of oxygen radical, is an important antioxidant that helps maintain the stability of blood pressure and antioxidant stress. Uric acid sodium can remove reactive oxygen species (ROS) such as singlet oxygen and peroxynitrite, inhibiting lipid peroxidation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1198-77-2 |
| Pricing | Inquire |
| Cas | 1198-77-2 |
| Molecular Weight | 190.11 |
| Molecular Formula | C5H4N4NaO3 |
| Canonical SMILES | C12=C(NC(=O)NC1=O)N=C(N2)[O-].[Na+] |