2',3'-Dideoxy-3'-fluoro-5-methylcytidine
2',3'-Dideoxy-3'-fluoro-5-methylcytidine, a potent antiviral compound widely employed in biomedical research, demonstrates exceptional efficacy against RNA viruses such as hepatitis C (HCV) and Zika (ZIKV). By perturbing viral RNA synthesis, this nucleoside analog effectively impedes viral replication. Owing to its strategically modified structure, this promising agent not only augments its therapeutic potential but also ameliorates its adverse effects. Thus, this compound holds immense promise in combating viral infections, representing a significant breakthrough in the field of antiviral therapeutics.
| Supplier | BOC Sciences |
|---|---|
| Product # | 115249-95-1 |
| Pricing | Inquire |
| Cas | 115249-95-1 |
| Molecular Weight | 243.23 |
| Molecular Formula | C10H14FN3O3 |
| Canonical SMILES | CC1=CN(C(=O)N=C1N)C2CC(C(O2)CO)F |