1,2,4-Benzenetricarboxylic Acid Benzyl Ester
1,2,4-Benzenetricarboxylic Acid Benzyl Ester is an intermediate in the synthesis of Trioctyl Trimellitate (T804400), a plasticizer that was evaluated for endocrine disrupting activities through estrogen receptor alpha binding assay.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB073947 |
| Pricing | Inquire |
| Cas | 16432-55-6 |
| Molecular Weight | 300.26 |
| Molecular Formula | C16H12O6 |
| Canonical SMILES | C1=CC=C(C=C1)COC(=O)C2=C(C=C(C=C2)C(=O)O)C(=O)O |