5'-O-DMT-N4-Benzoyl-3'-O-tert-butyldimethylsilyl-cytidine 2'-CE phosphoramidite
5'-O-DMT-N4-Benzoyl-3'-O-tert-butyldimethylsilyl-cytidine 2'-CE phosphoramidite, a highly acclaimed reagent in the realm of biomedicine, exhibits unparalleled significance. Notably, this phosphoramidite derivative finds widespread employment in the synthesis of altered oligonucleotides, exuding immense promise for gene therapy, drug conveyance, and diagnostic modalities.
| Supplier | BOC Sciences |
|---|---|
| Product # | 129470-47-9 |
| Pricing | Inquire |
| Cas | 129470-47-9 |
| Molecular Weight | 964.17 |
| Molecular Formula | C52H66N5O9PSi |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1C(C(OC1N2C=CC(=NC2=O)NC(=O)C3=CC=CC=C3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)O[Si](C)(C)C(C)(C)C |