3'-O-t-Bulyldimethylsilyl-4'-C-hydroxymethylthymidine
3'-O-t-Bulyldimethylsilyl-4'-C-hydroxymethylthymidine is a research chemical commonly used in the biomedicine industry. It plays a crucial role in the synthesis and development of antiviral drugs for the treatment of diseases caused by viral infections. This compound exhibits potent antiviral activity against various DNA viruses and is particularly effective in combating herpesviruses.
| Supplier | BOC Sciences |
|---|---|
| Product # | 139887-99-3 |
| Pricing | Inquire |
| Cas | 139887-99-3 |
| Molecular Weight | 386.52 |
| Molecular Formula | C17H30N2O6Si |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(O2)(CO)CO)O[Si](C)(C)C(C)(C)C |