2-Oxo Clopidogrel-[13C,d3] Hydrochloride (Mixture of Diastereomers)
2-Oxo Clopidogrel-[13C,d3] Hydrochloride (Mixture of Diastereomers) is the labelled salt of 2-Oxo Clopidogrel. 2-Oxo Clopidogrel is the essential intermediate metabolite from which the active metabolite of Clopidogel is formed.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-006376 |
| Pricing | Inquire |
| Cas | 1794713-84-0 |
| Molecular Weight | 378.29 |
| Molecular Formula | C15[13C]H13D3ClNO3S.HCl |
| Canonical SMILES | COC(=O)C(C1=CC=CC=C1Cl)N2CCC3C(=CC(=O)S3)C2.Cl |