N1,N2-Dimethyl-2'-O-methylguanosine
N1,N2-Dimethyl-2'-O-methylguanosine, a pivotal component in biomedicine, elucidates its paramountcy in diverse pathological conditions, particularly within the domain of antiviral investigation. This compound manifests noteworthy antiviral efficacy against distinct viral variants, thereby captivating interest in medicinal exploration for mitigating viral afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2305416-05-9 |
| Pricing | Inquire |
| Cas | 2305416-05-9 |
| Molecular Weight | 325.32 |
| Molecular Formula | C13H19N5O5 |
| Canonical SMILES | CNC1=NC2=C(C(=O)N1C)N=CN2C3C(C(C(O3)CO)O)OC |