Mycophenolate Mofetil Impurity A HCl
An impurity of Mycophenolate Mofetil which is a non-competitive, selective and reversible inhibitor of inosine monophosphate dehydrogenase I/II with IC50 of 39 nM and 27 nM, respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1322681-36-6 |
| Pricing | Inquire |
| Cas | 1322681-36-6 |
| Molecular Weight | 455.94 |
| Molecular Formula | C22H29NO7.HCl |
| Canonical SMILES | CC1=C2COC(=O)C2=C(C(=C1O)CC=C(C)CCC(=O)OCCN3CCOCC3)O |