5'-POM-(E)-vinyl phosphonate-2'-O-Me-U-3'-CE-Phosphoramidite
5'-POM-(E)-vinyl phosphonate-2'-O-Me-U-3'-CE-Phosphoramidite is a sophisticated biochemical utilized in the pharmaceutical industry. This molecule plays a vital role in the synthesis of antiviral medications targeted at treating diseases like Hepatitis C.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2706-341854 |
| Pricing | Inquire |
| Cas | 2172373-55-4 |
| Molecular Weight | 762.72 |
| Molecular Formula | C32H52N4O13P2 |
| Canonical SMILES | N#CCCOP(OC1C(OC(N2C=CC(=O)NC2=O)C1OC)C=CP(=O)(OCOC(=O)C(C)(C)C)OCOC(=O)C(C)(C)C)N(C(C)C)C(C)C |