Potassium 2,6-dimethoxypyridine-3-trifluoroborate
Potassium 2,6-dimethoxypyridine-3-trifluoroborate is a pivotal reagent extensively employed in the fabrication of diversified pharmaceuticals and agrochemicals. It assumes the role of a critical intermediary within the realm of potential drug candidates dedicated to the amelioration of neurological disorders, inflammatory diseases, and cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1374247-42-3 |
| Pricing | Inquire |
| Cas | 1374247-42-3 |
| Molecular Weight | 245.05 |
| Molecular Formula | C7H8BF3KNO2 |
| Canonical SMILES | [B-](C1=C(N=C(C=C1)OC)OC)(F)(F)F.[K+] |