3-(3-amino-3-carboxypropyl)uridine
3-(3-amino-3-carboxypropyl)uridine, an indispensable compound extensively applied in biomedical research and pharmaceutical advancement, assumes a pivotal function in the amalgamation of nucleic acids and RNA alteration. Its multifaceted attributes make it an invaluable tool for unraveling the intricate intricacies of RNA's structure, function, and the impact of selective modifications on a diverse array of ailments, encompassing cancer and neurodegenerative disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 52745-94-5 |
| Pricing | Inquire |
| Cas | 52745-94-5 |
| Molecular Weight | 345.19 |
| Molecular Formula | C13H19N3O8 |
| Canonical SMILES | C1=CN(C(=O)N(C1=O)CCC(C(=O)O)N)C2C(C(C(O2)CO)O)O |