Pemetrexed EP Impurity B
Pemetrexed EP Impurity B is one of pemetrexed impurities. Pemetrexed binds to and inhibits the enzyme thymidylate synthase (TS) which catalyses the methylation of 2'-deoxyuridine-5'-monophosphate (dUMP) to 2'-deoxythymidine-5'-monophosphate (dTMP), an essential precursor in DNA synthesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1802552-04-0 |
| Pricing | Inquire |
| Cas | 1802552-04-0 |
| Molecular Weight | 868.80 |
| Molecular Formula | C40H40N10O13 |
| Canonical SMILES | C1=CC(=CC=C1CCC2=C(NC3=C2C(=O)NC(=N3)N)C4(C5=C(NC4=O)N=C(NC5=O)N)CCC6=CC=C(C=C6)C(=O)NC(CCC(=O)O)C(=O)O)C(=O)NC(CCC(=O)O)C(=O)O |