Dihydrospinosyn A aglycone
It is an acid degradation product produced by hydrolysis of both saccharide groups of 3-ethoxy-5,6-dihydrospinosyn J, the major component of the commercial insecticide, spinetoram. It has only weak activity as an insecticide and the saccharides are considered essential for potent activity. It is commonly used as an insecticide for agricultural chemicals.
| Supplier | BOC Sciences |
|---|---|
| Product # | 727695-12-7 |
| Pricing | Inquire |
| Cas | 727695-12-7 |
| Molecular Weight | 404.54 |
| Molecular Formula | C24H36O5 |
| Canonical SMILES | CCC1CCCC(C(C(=O)C2=CC3C(C2CC(=O)O1)CCC4C3CC(C4)O)C)O |