1-(6-hydroxy-1,3-benzodioxol-5-yl)propan-1-one
1-(6-hydroxy-1,3-benzodioxol-5-yl)propan-1-one is a key intermediate used in the synthesis of pharmaceutical drugs targeting various diseases. Its versatile properties make it suitable for developing anticancer is anti-inflammatory and antiviral medications. With its unique molecular structure, it plays a crucial role in the biomedical industry for the research of a wide range of diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 18607-90-4 |
| Pricing | Inquire |
| Cas | 18607-90-4 |
| Molecular Weight | 194.18 |
| Molecular Formula | C10H10O4 |
| Canonical SMILES | CCC(=O)C1=CC2=C(C=C1O)OCO2 |