Damavaricin D
Damavaricin D is an ansamycin antibiotic isolated from the Streptovaricin complex produced by Streptomyces spectabilis. It is the biosynthetic precursor of Streptomycin D, and also has anti-Gram-positive bacteria, anti-Gram-negative bacteria and anti-fungal effects.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00784 |
| Pricing | Inquire |
| Cas | 59556-95-5 |
| Molecular Weight | 697.77 |
| Molecular Formula | C37H47NO12 |
| Canonical SMILES | CC1C=CC=C(C(=O)NC2=C(C(=O)C3=C(C(=C(C(=C3C2=O)O)C)O)C(=O)C(=CC(C(C(C(C(C(C(C1O)C)O)C(=O)OC)O)C)O)C)C)C)C |