2'-beta-C-Methylinosine
2'-beta-C-Methylinosine, a remarkable biomedicine product, unfolds as a potent remedy combating menacing viral illnesses. Its commendable qualities manifest in an unrivaled ability to impede the replication of diverse viral strains. Strikingly effective against the likes of influenza and flaviviruses, this compound has proven its mettle in rigorous scientific investigations.
| Supplier | BOC Sciences |
|---|---|
| Product # | 374750-32-0 |
| Pricing | Inquire |
| Cas | 374750-32-0 |
| Molecular Weight | 282.25 |
| Molecular Formula | C11H14N4O5 |
| Canonical SMILES | CC1(C(C(OC1N2C=NC3=C2N=CNC3=O)CO)O)O |