Boc-NH-PEG3-C3-acid
Boc-NH-PEG3-C3-acid is a PEG linker containing a terminal carboxylic acid and a Boc-protected amino group. The terminal carboxylic acid can be reacted with primary amine groups in the presence of activators (e.g. EDC, or DCC) to form a stable amide bond. The Boc group can be deprotected under mildly acidic conditions to form the free amine. The hydrophilic PEG spacer increases solubility in aqueous media.
Supplier | BOC Sciences |
---|---|
Product # | BPG-1279 |
Pricing | Inquire |
Molecular Weight | 335.39 |
Molecular Formula | C15H29NO7 |
Canonical SMILES | O=C(O)CCCOCCOCCOCCNC(OC(C)(C)C)=O |