2',3',5'-Tri-O-benzoyl-6-azauridine
2',3',5'-Tri-O-benzoyl-6-azauridine: a potent antiviral agent utilized in the biomedical sector, possessing activity against multiple RNA viruses, specifically including HIV-1, influenza A and B, as well as hepatitis C virus. The existing mechanism of action entails the repression of viral RNA synthesis and serves as a promising drug contender for dismantling viral infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1627-29-8 |
| Pricing | Inquire |
| Cas | 1627-29-8 |
| Molecular Weight | 557.51 |
| Molecular Formula | C29H23N3O9 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)OCC2C(C(C(O2)N3C(=O)NC(=O)C=N3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5 |