N1-Methoxy Pseudo UTP
N1-Methoxy Pseudo UTP (N1-Methoxy Pseudouridine-5'-triphosphate) is a modified nucleotide where a methoxy group is attached to the nitrogen at the 1st position of pseudouridine, and it is linked to a triphosphate group at the 5' position. This modification can enhance the stability and functionality of RNA, making it useful in the synthesis of modified RNA molecules. N1-Methoxy Pseudo UTP is often utilized in RNA research, including studies on RNA structure and function, RNA-protein interactions, and the development of therapeutically relevant RNA, such as mRNA vaccines and RNA-based therapeutics.
Supplier | BOC Sciences |
---|---|
Product # | BRP-00383 |
Pricing | Inquire |
Molecular Weight | 514.17 |
Molecular Formula | C10H17N2O16P3 |
Canonical SMILES | CON1C=C(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O |