Isomurrayafoline B
Isomurrayafoline B, a carbazole alkaloid, is extracted from the stem and leaves of Cortex corydalis and found in Murraya euchrestifolia and Murraya koenigii, and has neuroprotective functions and cytotoxic activities.
| Supplier | BOC Sciences |
|---|---|
| Product # | 107903-15-1 |
| Pricing | Inquire |
| Cas | 107903-15-1 |
| Molecular Weight | 295.38 |
| Molecular Formula | C19H21NO2 |
| Canonical SMILES | CC1=CC2=C(C=C1O)NC3=C2C=CC(=C3CC=C(C)C)OC |