Amoxicillin-[13C6]
Amoxicillin-[13C6] is the labelled analogue of Amoxicillin. Amoxicillin is a moderate-spectrum, bacteriolytic, β-lactam antibiotic used to treat bacterial infections caused by susceptible microorganisms. It is usually the drug of choice within the class because it is better-absorbed, following oral administration, than other β-lactam antibiotics. Amoxicillin is susceptible to degradation by β-lactamase-producing bacteria, which are resistant to a narrow spectrum of β-lactam antibiotics, such as penicillin.
Supplier | BOC Sciences |
---|---|
Product # | BLP-000974 |
Pricing | Inquire |
Molecular Weight | 371.40 |
Molecular Formula | C10[13C]6H19N3O5S |
Canonical SMILES | CC1(C(N2C(S1)C(C2=O)NC(=O)C(C3=CC=C(C=C3)O)N)C(=O)O)C |