1-Methylindole-2-boronic acid, pinacol ester
1-Methylindole-2-boronic acid, pinacol ester is an essential intermediate for the synthesis of bioactive molecules. It is particularly suitable for the development of therapeutics targeting bacterial pathogenesis and inflammation-related diseases, and it expands the applicability and robustness of biomedical research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 596819-10-2 |
| Pricing | Inquire |
| Cas | 596819-10-2 |
| Molecular Weight | 257.1 |
| Molecular Formula | C15H20BNO2 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=CC=CC=C3N2C |