4,5-Imidazoledicarboxylic Acid
4,5-Imidazoledicarboxylic Acid (CAS# 570-22-9) is an intermediate used in the synthesis of N-substituted cyclic imides with anticancer and anti-inflammatory activities. it is also used to prepare imidazolecarboxamide derivatives with cannabinoid CB2 receptor antagonistic activities.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB029564 |
| Pricing | Inquire |
| Cas | 570-22-9 |
| Molecular Weight | 156.10 |
| Molecular Formula | C5H4N2O4 |
| Canonical SMILES | C1=NC(=C(N1)C(=O)O)C(=O)O |