MDL-72274 HCl
MDL-72274 is a selective SSAO inhibitor. It is a potent (IC50 = 10(-9) M) inhibitor of both MAO-B and SSAO, with 190-fold lower affinity for MAO-A. MDL-72974 can be used for the treatment of Parkinson diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 85278-24-6 |
| Pricing | Inquire |
| Cas | 85278-24-6 |
| Molecular Weight | 204.09 |
| Molecular Formula | C9H11Cl2N |
| Canonical SMILES | NC/C(C1=CC=CC=C1)=C/Cl.[H]Cl |