Pomalidomide-PEG1-C2-N3
Pomalidomide-PEG1-C2-N3 is a synthetic E3 ligand-linker sonjugate containing a Pomalidomide-based cereblon ligand and a PEG linker with a O(CH2)2 monnomer, which is an intermediate in the synthesis of PROTAC degradation agent induces CDK6 degradation with a DC50 of 2.1 nM.
| Supplier | BOC Sciences |
|---|---|
| Product # | BP-100101 |
| Pricing | Inquire |
| Cas | 2271036-44-1 |
| Molecular Weight | 386.36 |
| Molecular Formula | C₁₇H₁₈N₆O₅ |
| Canonical SMILES | [N-]=[N+]=NCCOCCNC1=C2C(N(C(C2=CC=C1)=O)C3CCC(NC3=O)=O)=O |