N-Boc-N'-(PEG1-t-butyl ester)-L-Lysine-amido-Mal
N-Boc-N'-(PEG1-t-butyl ester)-L-Lysine-amido-Mal is the amino acid, lysine, with a maleimide at its C-terminus, a Boc-protecting group on its α-amine, and an amido-PEG1-t-butyl ester on its ε-amine. Maleimide is a thiol-reactive covalent group used to conjugate cysteine residues, while the Boc and the t-butyl ester can be later deprotected to perform further reactions.
| Supplier | BOC Sciences |
|---|---|
| Product # | BPG-4362 |
| Pricing | Inquire |
| Cas | 2665661-79-8 |
| Molecular Weight | 568.7 |
| Molecular Formula | C27H44N4O9 |
| Canonical SMILES | CC(C)(C)OC(=O)CCOCCC(=O)NCCCCC(C(=O)NCCN1C(=O)C=CC1=O)NC(=O)OC(C)(C)C |