WS75624 B
WS75624 B is an endothelin converting enzyme (ECE) inhibitor isolated from the fermentation broth of Saccharothrix sp. No. 75624. It also showed other metalloprotease (collagenase and neutral endopeptidase) inhibitory activity with IC50 value of 1 mM/ml.
Supplier | BOC Sciences |
---|---|
Product # | BBF-01657 |
Pricing | Inquire |
Molecular Weight | 380.5 |
Molecular Formula | C18H24N2O5S |
Canonical SMILES | CC(CCCCCC1=NC(=CS1)C2=C(C(=CC(=N2)C(=O)O)OC)OC)O |